Smiles Code
CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)O
Chloroform, DMSO, Methanol
Building Blocks; Amino Acids;
N-Cbz-L-Leucine is an N-Cbz-protected form of L-Leucine (L330110). L-Leucine is an essential amino acid that induces a sharp decrease in blood glucose levels in individuals with idiopathic familial hypoglycemia, but has no known effects on normal, healthy individuals. L-Leucine also acts as an Isoleucine (I820210) antagonist in the rat, causing delays in growth, and is a potential tumour promoter of bladder cancer.