Smiles Code
C[C@@H](NC(=O)OCc1ccccc1)C(=O)O
Building Blocks; Chiral Molecules; Amino Acids;
N-Cbz-D-alanine is the Cbz-protected form of D-Alanine (A480995). D-Alanine is an amino acid that is commonly found in bacteria, such as Streptococcus faecalis. It is essential for the biosynthesis of peptidoglycan crosslinking sub-units that are used for bacterial cell walls. D-Alanine is also known to cause cytotoxic oxidative stress in brain tumour cells.