Smiles Code
CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c2cnccn2)B3OB(OB(O3)[C@H](CC(C)C)NC(=O)[C@H](Cc4ccccc4)NC(=O)c5cnccn5)[C@H](CC(C)C)NC(=O)[C@H](Cc6ccccc6)NC(=O)c7cnccn7
DMSO (Slightly), Methanol (Slightly)
Standards; Enzyme Activators and Inhibitors; Pharmaceutical/API Drug Impurities/Metabolites;
Bortezomib Trimer is derived from Bortezomib (B675700), which is the first proteasome inhibitor to be approved by the US FDA for multiple myeloma, a blood cancer. A reversible inhibitor of the 26S proteasome-a barrel-shaped multiprotein particle found in the nucleus and cytosol of all eukaryotic cells. Targets the ubiquitin-proteasome pathway.